C16H31NO6S2 — CID 121297116
3-[acetyl-[(3S)-1,3,5-trimethylcyclooctyl]sulfonylamino]propane-1-sulfonic acid (PubChem CID 121297116) has the molecular formula C16H31NO6S2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 3-[acetyl-[(3S)-1,3,5-trimethylcyclooctyl]sulfonylamino]propane-1-sulfonic acid.
| Compound Name | 3-[acetyl-[(3S)-1,3,5-trimethylcyclooctyl]sulfonylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 121297116 |
| Molecular Formula | C16H31NO6S2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 3-[acetyl-[(3S)-1,3,5-trimethylcyclooctyl]sulfonylamino]propane-1-sulfonic acid |
| SMILES | CC(=O)N(CCCS(=O)(=O)O)S(=O)(=O)C1(C)CCCC(C)C[C@H](C)C1 |
| InChI | InChI=1S/C16H31NO6S2/c1-13-7-5-8-16(4,12-14(2)11-13)25(22,23)17(15(3)18)9-6-10-24(19,20)21/h13-14H,5-12H2,1-4H3,(H,19,20,21)/t13?,14-,16?/m0/s1 |
| InChIKey | OZMZLEXEVHURFB-BBBYJDLNSA-N |
| XLogP | 2.44 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|