C45H31FN2O — CID 121297504
9-(4-fluorophenyl)-6-[9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-phenylxanthen-2-yl]carbazole-3-carbonitrile (PubChem CID 121297504) has the molecular formula C45H31FN2O and a molecular weight of 634.75 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-6-[9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-phenylxanthen-2-yl]carbazole-3-carbonitrile.
| Compound Name | 9-(4-fluorophenyl)-6-[9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-phenylxanthen-2-yl]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 121297504 |
| Molecular Formula | C45H31FN2O |
| Molecular Weight | 634.75 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | 9-(4-fluorophenyl)-6-[9-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-phenylxanthen-2-yl]carbazole-3-carbonitrile |
| SMILES | C=C(/C=C\C=C/C)C1(c2ccccc2)c2ccccc2Oc2ccc(-c3ccc4c(c3)c3cc(C#N)ccc3n4-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C45H31FN2O/c1-3-4-6-11-30(2)45(34-12-7-5-8-13-34)39-14-9-10-15-43(39)49-44-25-18-33(28-40(44)45)32-17-24-42-38(27-32)37-26-31(29-47)16-23-41(37)48(42)36-21-19-35(46)20-22-36/h3-28H,2H2,1H3/b4-3-,11-6- |
| InChIKey | OMKJPJBQESGPJL-ZRTVSTLASA-N |
| XLogP | 11.59 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.75 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|