C35H37NO8 — CID 121297653
(1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl) 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate (PubChem CID 121297653) has the molecular formula C35H37NO8 and a molecular weight of 599.68 g/mol. Its IUPAC name is (1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl) 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate.
| Compound Name | (1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl) 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 121297653 |
| Molecular Formula | C35H37NO8 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | (1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl) 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate |
| SMILES | Cc1ccc(C(=O)c2ccc(CC(=O)OC3C4(C(C)C)OC4C4OC45C4(C)CCC6=C(COC6=O)C4CC4OC435)n2C)cc1 |
| InChI | InChI=1S/C35H37NO8/c1-17(2)33-28(43-33)29-35(44-29)32(4)13-12-21-22(16-40-30(21)39)23(32)15-25-34(35,42-25)31(33)41-26(37)14-20-10-11-24(36(20)5)27(38)19-8-6-18(3)7-9-19/h6-11,17,23,25,28-29,31H,12-16H2,1-5H3 |
| InChIKey | IHOYSWCJEJSBMG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 112.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|