C40H24N4S2 — CID 121297736
2-[5-[2-naphthalen-2-yl-10-[5-(1,3-thiazol-2-yl)-3-pyridinyl]anthracen-9-yl]-3-pyridinyl]-1,3-thiazole (PubChem CID 121297736) has the molecular formula C40H24N4S2 and a molecular weight of 624.79 g/mol. Its IUPAC name is 2-[5-[2-naphthalen-2-yl-10-[5-(1,3-thiazol-2-yl)-3-pyridinyl]anthracen-9-yl]-3-pyridinyl]-1,3-thiazole.
| Compound Name | 2-[5-[2-naphthalen-2-yl-10-[5-(1,3-thiazol-2-yl)-3-pyridinyl]anthracen-9-yl]-3-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 121297736 |
| Molecular Formula | C40H24N4S2 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 2-[5-[2-naphthalen-2-yl-10-[5-(1,3-thiazol-2-yl)-3-pyridinyl]anthracen-9-yl]-3-pyridinyl]-1,3-thiazole |
| SMILES | c1ccc2cc(-c3ccc4c(-c5cncc(-c6nccs6)c5)c5ccccc5c(-c5cncc(-c6nccs6)c5)c4c3)ccc2c1 |
| InChI | InChI=1S/C40H24N4S2/c1-2-6-26-17-27(10-9-25(26)5-1)28-11-12-35-36(20-28)38(30-19-32(24-42-22-30)40-44-14-16-46-40)34-8-4-3-7-33(34)37(35)29-18-31(23-41-21-29)39-43-13-15-45-39/h1-24H |
| InChIKey | FHEDIHLDLVVHGU-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|