C40H24N4O2 — CID 121297747
2-[2-[2-naphthalen-1-yl-10-[4-(1,3-oxazol-2-yl)-2-pyridinyl]anthracen-9-yl]-4-pyridinyl]-1,3-oxazole (PubChem CID 121297747) has the molecular formula C40H24N4O2 and a molecular weight of 592.66 g/mol. Its IUPAC name is 2-[2-[2-naphthalen-1-yl-10-[4-(1,3-oxazol-2-yl)-2-pyridinyl]anthracen-9-yl]-4-pyridinyl]-1,3-oxazole.
| Compound Name | 2-[2-[2-naphthalen-1-yl-10-[4-(1,3-oxazol-2-yl)-2-pyridinyl]anthracen-9-yl]-4-pyridinyl]-1,3-oxazole |
|---|---|
| PubChem CID | 121297747 |
| Molecular Formula | C40H24N4O2 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 2-[2-[2-naphthalen-1-yl-10-[4-(1,3-oxazol-2-yl)-2-pyridinyl]anthracen-9-yl]-4-pyridinyl]-1,3-oxazole |
| SMILES | c1ccc2c(-c3ccc4c(-c5cc(-c6ncco6)ccn5)c5ccccc5c(-c5cc(-c6ncco6)ccn5)c4c3)cccc2c1 |
| InChI | InChI=1S/C40H24N4O2/c1-2-8-29-25(6-1)7-5-11-30(29)26-12-13-33-34(22-26)38(36-24-28(15-17-42-36)40-44-19-21-46-40)32-10-4-3-9-31(32)37(33)35-23-27(14-16-41-35)39-43-18-20-45-39/h1-24H |
| InChIKey | FYVDMOQZMNRKBA-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|