C24H44O4 — CID 121297999
[(E,5R,8S)-5-hydroxy-3,4,7,7,8-pentamethyl-6-oxodec-3-en-2-yl] (3S)-2,3,5-trimethylhexanoate (PubChem CID 121297999) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is [(E,5R,8S)-5-hydroxy-3,4,7,7,8-pentamethyl-6-oxodec-3-en-2-yl] (3S)-2,3,5-trimethylhexanoate.
| Compound Name | [(E,5R,8S)-5-hydroxy-3,4,7,7,8-pentamethyl-6-oxodec-3-en-2-yl] (3S)-2,3,5-trimethylhexanoate |
|---|---|
| PubChem CID | 121297999 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | [(E,5R,8S)-5-hydroxy-3,4,7,7,8-pentamethyl-6-oxodec-3-en-2-yl] (3S)-2,3,5-trimethylhexanoate |
| SMILES | CC[C@H](C)C(C)(C)C(=O)[C@H](O)/C(C)=C(\C)C(C)OC(=O)C(C)[C@@H](C)CC(C)C |
| InChI | InChI=1S/C24H44O4/c1-12-16(5)24(10,11)22(26)21(25)19(8)18(7)20(9)28-23(27)17(6)15(4)13-14(2)3/h14-17,20-21,25H,12-13H2,1-11H3/b19-18+/t15-,16-,17?,20?,21+/m0/s1 |
| InChIKey | QMCPDENBPKTTAY-XBFRXTJQSA-N |
| XLogP | 5.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|