About (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol
(4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol (PubChem CID 121299049) has the molecular formula C20H23N3O
and a molecular weight of 321.42 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol |
| PubChem CID | 121299049 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CC1(C)C[C@@H](Nc2ncc(C#Cc3ccccc3)cn2)CCC1O |
| InChI | InChI=1S/C20H23N3O/c1-20(2)12-17(10-11-18(20)24)23-19-21-13-16(14-22-19)9-8-15-6-4-3-5-7-15/h3-7,13-14,17-18,24H,10-12H2,1-2H3,(H,21,22,23)/t17-,18?/m0/s1 |
| InChIKey | KQXHKJNRLPBAFV-ZENAZSQFSA-N |
| XLogP | 3.23 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol?
The IUPAC name of (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol (CID 121299049) is (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol.
What is the SMILES notation for (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol?
The canonical SMILES for (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol is CC1(C)C[C@@H](Nc2ncc(C#Cc3ccccc3)cn2)CCC1O.
What is the InChIKey of (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol?
The InChIKey is KQXHKJNRLPBAFV-ZENAZSQFSA-N. The full InChI is InChI=1S/C20H23N3O/c1-20(2)12-17(10-11-18(20)24)23-19-21-13-16(14-22-19)9-8-15-6-4-3-5-7-15/h3-7,13-14,17-18,24H,10-12H2,1-2H3,(H,21,22,23)/t17-,18?/m0/s1.
What are the key properties of (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol?
(4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol has a molecular weight of 321.42 g/mol, XLogP of 3.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-dimethyl-4-[[5-(2-phenylethynyl)pyrimidin-2-yl]amino]cyclohexan-1-ol is sourced from PubChem (CID 121299049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).