C21H17F6N3O5S — CID 121300139
phenol;2,2,2-trifluoroacetate;2,2,2-trifluoro-1-[5-(1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)thiophen-2-yl]ethanone (PubChem CID 121300139) has the molecular formula C21H17F6N3O5S and a molecular weight of 537.44 g/mol. Its IUPAC name is phenol;2,2,2-trifluoroacetate;2,2,2-trifluoro-1-[5-(1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)thiophen-2-yl]ethanone.
| Compound Name | phenol;2,2,2-trifluoroacetate;2,2,2-trifluoro-1-[5-(1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 121300139 |
| Molecular Formula | C21H17F6N3O5S |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | phenol;2,2,2-trifluoroacetate;2,2,2-trifluoro-1-[5-(1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)thiophen-2-yl]ethanone |
| SMILES | O=C([O-])C(F)(F)F.O=C(c1ccc(C(=O)C(F)(F)F)s1)N1CC[n+]2cc[nH]c2C1.Oc1ccccc1 |
| InChI | InChI=1S/C13H10F3N3O2S.C6H6O.C2HF3O2/c14-13(15,16)11(20)8-1-2-9(22-8)12(21)19-6-5-18-4-3-17-10(18)7-19;7-6-4-2-1-3-5-6;3-2(4,5)1(6)7/h1-4H,5-7H2;1-5,7H;(H,6,7) |
| InChIKey | MHYKYJRYFYPMCE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|