About 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride
2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride (PubChem CID 121300182) has the molecular formula C11H10ClF3N4
and a molecular weight of 290.68 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride |
| PubChem CID | 121300182 |
| Molecular Formula | C11H10ClF3N4 |
| Molecular Weight | 290.68 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride |
| SMILES | Cl.Nc1cnc(-c2ccc(C(F)(F)F)cc2)nc1N |
| InChI | InChI=1S/C11H9F3N4.ClH/c12-11(13,14)7-3-1-6(2-4-7)10-17-5-8(15)9(16)18-10;/h1-5H,15H2,(H2,16,17,18);1H |
| InChIKey | XFZGWAJIUOPVBI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride?
The IUPAC name of 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride (CID 121300182) is 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride.
What is the SMILES notation for 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride?
The canonical SMILES for 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride is Cl.Nc1cnc(-c2ccc(C(F)(F)F)cc2)nc1N.
What is the InChIKey of 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride?
The InChIKey is XFZGWAJIUOPVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N4.ClH/c12-11(13,14)7-3-1-6(2-4-7)10-17-5-8(15)9(16)18-10;/h1-5H,15H2,(H2,16,17,18);1H.
What are the key properties of 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride?
2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride has a molecular weight of 290.68 g/mol, XLogP of 2.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)phenyl]pyrimidine-4,5-diamine;hydrochloride is sourced from PubChem (CID 121300182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).