C8H10IN3O — CID 121300390
3-iodo-7,7-dimethyl-5,6-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 121300390) has the molecular formula C8H10IN3O and a molecular weight of 291.09 g/mol. Its IUPAC name is 3-iodo-7,7-dimethyl-5,6-dihydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 3-iodo-7,7-dimethyl-5,6-dihydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 121300390 |
| Molecular Formula | C8H10IN3O |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 3-iodo-7,7-dimethyl-5,6-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CC1(C)CNC(=O)c2c(I)cnn21 |
| InChI | InChI=1S/C8H10IN3O/c1-8(2)4-10-7(13)6-5(9)3-11-12(6)8/h3H,4H2,1-2H3,(H,10,13) |
| InChIKey | RJDQSDKCSICUTG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|