C26H35NO4 — CID 121300761
(1S,9R,10S,12S,14S)-13-(2-hydroxypentan-2-yl)-4,14-dimethoxy-18-methyl-18-azaheptacyclo[7.6.3.110,13.01,10.02,7.012,14.012,15]nonadeca-2(7),3,5-trien-3-ol (PubChem CID 121300761) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is (1S,9R,10S,12S,14S)-13-(2-hydroxypentan-2-yl)-4,14-dimethoxy-18-methyl-18-azaheptacyclo[7.6.3.110,13.01,10.02,7.012,14.012,15]nonadeca-2(7),3,5-trien-3-ol.
| Compound Name | (1S,9R,10S,12S,14S)-13-(2-hydroxypentan-2-yl)-4,14-dimethoxy-18-methyl-18-azaheptacyclo[7.6.3.110,13.01,10.02,7.012,14.012,15]nonadeca-2(7),3,5-trien-3-ol |
|---|---|
| PubChem CID | 121300761 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (1S,9R,10S,12S,14S)-13-(2-hydroxypentan-2-yl)-4,14-dimethoxy-18-methyl-18-azaheptacyclo[7.6.3.110,13.01,10.02,7.012,14.012,15]nonadeca-2(7),3,5-trien-3-ol |
| SMILES | CCCC(C)(O)C12C[C@@]34C[C@]15C(C31CCN(C)[C@@H]4Cc3ccc(OC)c(O)c31)[C@@]25OC |
| InChI | InChI=1S/C26H35NO4/c1-6-9-21(2,29)25-14-22-13-24(25)20(26(24,25)31-5)23(22)10-11-27(3)17(22)12-15-7-8-16(30-4)19(28)18(15)23/h7-8,17,20,28-29H,6,9-14H2,1-5H3/t17-,20?,21?,22-,23?,24+,25?,26+/m1/s1 |
| InChIKey | QYISZLQUQDQRTA-HIIBXMDNSA-N |
| XLogP | 3.25 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |