C16H33NO3 — CID 121300874
(1R,2R,3R,4S,5R)-2-amino-4-butoxy-5-(butoxymethyl)-3-methylcyclohexan-1-ol (PubChem CID 121300874) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is (1R,2R,3R,4S,5R)-2-amino-4-butoxy-5-(butoxymethyl)-3-methylcyclohexan-1-ol.
| Compound Name | (1R,2R,3R,4S,5R)-2-amino-4-butoxy-5-(butoxymethyl)-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 121300874 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | (1R,2R,3R,4S,5R)-2-amino-4-butoxy-5-(butoxymethyl)-3-methylcyclohexan-1-ol |
| SMILES | CCCCOC[C@H]1C[C@@H](O)[C@H](N)[C@@H](C)[C@@H]1OCCCC |
| InChI | InChI=1S/C16H33NO3/c1-4-6-8-19-11-13-10-14(18)15(17)12(3)16(13)20-9-7-5-2/h12-16,18H,4-11,17H2,1-3H3/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | FTCMXBUFGKATTI-QCODTGAPSA-N |
| XLogP | 2.33 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|