C18H12F5KN2O — CID 121301772
potassium 4-(benzhydrylidenehydrazinylidene)-1,1,1,5,5-pentafluoropent-2-en-2-olate (PubChem CID 121301772) has the molecular formula C18H12F5KN2O and a molecular weight of 406.40 g/mol. Its IUPAC name is potassium 4-(benzhydrylidenehydrazinylidene)-1,1,1,5,5-pentafluoropent-2-en-2-olate.
| Compound Name | potassium 4-(benzhydrylidenehydrazinylidene)-1,1,1,5,5-pentafluoropent-2-en-2-olate |
|---|---|
| PubChem CID | 121301772 |
| Molecular Formula | C18H12F5KN2O |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | potassium 4-(benzhydrylidenehydrazinylidene)-1,1,1,5,5-pentafluoropent-2-en-2-olate |
| SMILES | [K+].[O-]C(=CC(=NN=C(c1ccccc1)c1ccccc1)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H13F5N2O.K/c19-17(20)14(11-15(26)18(21,22)23)24-25-16(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-11,17,26H;/q;+1/p-1 |
| InChIKey | WYVMADQKXJTNGX-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|