About ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate
ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate (PubChem CID 121301980) has the molecular formula C11H13F2NO2S
and a molecular weight of 261.29 g/mol. Its IUPAC name is ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate |
| PubChem CID | 121301980 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(CC2CC(F)(F)C2)cs1 |
| InChI | InChI=1S/C11H13F2NO2S/c1-2-16-10(15)9-14-8(6-17-9)3-7-4-11(12,13)5-7/h6-7H,2-5H2,1H3 |
| InChIKey | DTNCUKMWFITMLX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate?
The IUPAC name of ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate (CID 121301980) is ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate.
What is the SMILES notation for ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate?
The canonical SMILES for ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate is CCOC(=O)c1nc(CC2CC(F)(F)C2)cs1.
What is the InChIKey of ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate?
The InChIKey is DTNCUKMWFITMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO2S/c1-2-16-10(15)9-14-8(6-17-9)3-7-4-11(12,13)5-7/h6-7H,2-5H2,1H3.
What are the key properties of ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate?
ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate has a molecular weight of 261.29 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(3,3-difluorocyclobutyl)methyl]-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 121301980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).