About 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide
4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide (PubChem CID 121302014) has the molecular formula C9H8BrClF3NO2S
and a molecular weight of 366.59 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide |
| PubChem CID | 121302014 |
| Molecular Formula | C9H8BrClF3NO2S |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 364.91 |
| IUPAC Name | 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(Br)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H8BrClF3NO2S/c1-5(9(12,13)14)15-18(16,17)6-2-3-7(10)8(11)4-6/h2-5,15H,1H3 |
| InChIKey | MORLRYJKTXXZDZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide?
The IUPAC name of 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide (CID 121302014) is 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide.
What is the SMILES notation for 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide?
The canonical SMILES for 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide is CC(NS(=O)(=O)c1ccc(Br)c(Cl)c1)C(F)(F)F.
What is the InChIKey of 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide?
The InChIKey is MORLRYJKTXXZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClF3NO2S/c1-5(9(12,13)14)15-18(16,17)6-2-3-7(10)8(11)4-6/h2-5,15H,1H3.
What are the key properties of 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide?
4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide has a molecular weight of 366.59 g/mol, XLogP of 3.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-chloro-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide is sourced from PubChem (CID 121302014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).