About 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione
4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione (PubChem CID 121302035) has the molecular formula C9H8BrNS
and a molecular weight of 242.14 g/mol. Its IUPAC name is 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione.
Molecular Properties
| Compound Name | 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione |
| PubChem CID | 121302035 |
| Molecular Formula | C9H8BrNS |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 240.96 |
| IUPAC Name | 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione |
| SMILES | S=C1NC=C(Br)C2=CC=CCC12 |
| InChI | InChI=1S/C9H8BrNS/c10-8-5-11-9(12)7-4-2-1-3-6(7)8/h1-3,5,7H,4H2,(H,11,12) |
| InChIKey | MLPNKTOQMWMEQN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione?
The IUPAC name of 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione (CID 121302035) is 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione.
What is the SMILES notation for 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione?
The canonical SMILES for 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione is S=C1NC=C(Br)C2=CC=CCC12.
What is the InChIKey of 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione?
The InChIKey is MLPNKTOQMWMEQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNS/c10-8-5-11-9(12)7-4-2-1-3-6(7)8/h1-3,5,7H,4H2,(H,11,12).
What are the key properties of 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione?
4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione has a molecular weight of 242.14 g/mol, XLogP of 2.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-8,8a-dihydro-2H-isoquinoline-1-thione is sourced from PubChem (CID 121302035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).