C29H61N3 — CID 121302604
1,1,3,3-Tetrakis(5-methylhexyl)guanidine (PubChem CID 121302604) has the molecular formula C29H61N3 and a molecular weight of 451.80 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(5-methylhexyl)guanidine.
| Compound Name | 1,1,3,3-Tetrakis(5-methylhexyl)guanidine |
|---|---|
| PubChem CID | 121302604 |
| Molecular Formula | C29H61N3 |
| Molecular Weight | 451.80 g/mol |
| Exact Mass | 451.49 |
| IUPAC Name | 1,1,3,3-tetrakis(5-methylhexyl)guanidine |
| SMILES | CC(C)CCCCN(CCCCC(C)C)C(=N)N(CCCCC(C)C)CCCCC(C)C |
| InChI | InChI=1S/C29H61N3/c1-25(2)17-9-13-21-31(22-14-10-18-26(3)4)29(30)32(23-15-11-19-27(5)6)24-16-12-20-28(7)8/h25-28,30H,9-24H2,1-8H3 |
| InChIKey | KJWNIEBKJKHLNG-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 30.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | 358 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.80 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|