C21H45N3 — CID 121302630
1,1,3,3-tetrakis(3-methylbutyl)guanidine (PubChem CID 121302630) has the molecular formula C21H45N3 and a molecular weight of 339.61 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(3-methylbutyl)guanidine.
| Compound Name | 1,1,3,3-tetrakis(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 121302630 |
| Molecular Formula | C21H45N3 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.36 |
| IUPAC Name | 1,1,3,3-tetrakis(3-methylbutyl)guanidine |
| SMILES | [H]N=C(N(CCC(C)C)CCC(C)C)N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C21H45N3/c1-17(2)9-13-23(14-10-18(3)4)21(22)24(15-11-19(5)6)16-12-20(7)8/h17-20,22H,9-16H2,1-8H3 |
| InChIKey | PMYGIRCJQBUKGX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|