C37H77N3 — CID 121302639
1,1,3,3-tetrakis(2-methyloctan-2-yl)guanidine (PubChem CID 121302639) has the molecular formula C37H77N3 and a molecular weight of 564.04 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(2-methyloctan-2-yl)guanidine.
| Compound Name | 1,1,3,3-tetrakis(2-methyloctan-2-yl)guanidine |
|---|---|
| PubChem CID | 121302639 |
| Molecular Formula | C37H77N3 |
| Molecular Weight | 564.04 g/mol |
| Exact Mass | 563.61 |
| IUPAC Name | 1,1,3,3-tetrakis(2-methyloctan-2-yl)guanidine |
| SMILES | [H]N=C(N(C(C)(C)CCCCCC)C(C)(C)CCCCCC)N(C(C)(C)CCCCCC)C(C)(C)CCCCCC |
| InChI | InChI=1S/C37H77N3/c1-13-17-21-25-29-34(5,6)39(35(7,8)30-26-22-18-14-2)33(38)40(36(9,10)31-27-23-19-15-3)37(11,12)32-28-24-20-16-4/h38H,13-32H2,1-12H3 |
| InChIKey | AHHIXWNWFPLYOT-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.04 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|