About 2-N-acetyl-1H-azepine-2,3-dicarboxamide
2-N-acetyl-1H-azepine-2,3-dicarboxamide (PubChem CID 121302748) has the molecular formula C10H11N3O3
and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-N-acetyl-1H-azepine-2,3-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-acetyl-1H-azepine-2,3-dicarboxamide |
| PubChem CID | 121302748 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-N-acetyl-1H-azepine-2,3-dicarboxamide |
| SMILES | CC(=O)NC(=O)C1=C(C(N)=O)C=CC=CN1 |
| InChI | InChI=1S/C10H11N3O3/c1-6(14)13-10(16)8-7(9(11)15)4-2-3-5-12-8/h2-5,12H,1H3,(H2,11,15)(H,13,14,16) |
| InChIKey | AOLMLZWDBZZWLJ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-acetyl-1H-azepine-2,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-acetyl-1H-azepine-2,3-dicarboxamide?
The IUPAC name of 2-N-acetyl-1H-azepine-2,3-dicarboxamide (CID 121302748) is 2-N-acetyl-1H-azepine-2,3-dicarboxamide.
What is the SMILES notation for 2-N-acetyl-1H-azepine-2,3-dicarboxamide?
The canonical SMILES for 2-N-acetyl-1H-azepine-2,3-dicarboxamide is CC(=O)NC(=O)C1=C(C(N)=O)C=CC=CN1.
What is the InChIKey of 2-N-acetyl-1H-azepine-2,3-dicarboxamide?
The InChIKey is AOLMLZWDBZZWLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3/c1-6(14)13-10(16)8-7(9(11)15)4-2-3-5-12-8/h2-5,12H,1H3,(H2,11,15)(H,13,14,16).
What are the key properties of 2-N-acetyl-1H-azepine-2,3-dicarboxamide?
2-N-acetyl-1H-azepine-2,3-dicarboxamide has a molecular weight of 221.22 g/mol, XLogP of -0.94, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-acetyl-1H-azepine-2,3-dicarboxamide is sourced from PubChem (CID 121302748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).