C9H3BrClF7O — CID 121303141
2-(4-bromo-3-chloro-2-fluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 121303141) has the molecular formula C9H3BrClF7O and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(4-bromo-3-chloro-2-fluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(4-bromo-3-chloro-2-fluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 121303141 |
| Molecular Formula | C9H3BrClF7O |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 373.89 |
| IUPAC Name | 2-(4-bromo-3-chloro-2-fluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(Br)c(Cl)c1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3BrClF7O/c10-4-2-1-3(6(12)5(4)11)7(19,8(13,14)15)9(16,17)18/h1-2,19H |
| InChIKey | JLUXXEQQXHENFG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|