C26H25F7N4O4S — CID 121303178
4-(4-fluoropiperidine-1-carbonyl)-5-[8-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)quinolin-5-yl]-N-(2-hydroxy-2-methylpropyl)-1,3-thiazole-2-carboxamide (PubChem CID 121303178) has the molecular formula C26H25F7N4O4S and a molecular weight of 622.56 g/mol. Its IUPAC name is 4-(4-fluoropiperidine-1-carbonyl)-5-[8-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)quinolin-5-yl]-N-(2-hydroxy-2-methylpropyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 4-(4-fluoropiperidine-1-carbonyl)-5-[8-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)quinolin-5-yl]-N-(2-hydroxy-2-methylpropyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 121303178 |
| Molecular Formula | C26H25F7N4O4S |
| Molecular Weight | 622.56 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | 4-(4-fluoropiperidine-1-carbonyl)-5-[8-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)quinolin-5-yl]-N-(2-hydroxy-2-methylpropyl)-1,3-thiazole-2-carboxamide |
| SMILES | CC(C)(O)CNC(=O)c1nc(C(=O)N2CCC(F)CC2)c(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)c3ncccc23)s1 |
| InChI | InChI=1S/C26H25F7N4O4S/c1-23(2,40)12-35-20(38)21-36-18(22(39)37-10-7-13(27)8-11-37)19(42-21)15-5-6-16(17-14(15)4-3-9-34-17)24(41,25(28,29)30)26(31,32)33/h3-6,9,13,40-41H,7-8,10-12H2,1-2H3,(H,35,38) |
| InChIKey | JNACMGUBYJYYFF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |