C10H16O8 — CID 121303625
(3R,4S,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxo-3-prop-2-enylheptanoic acid (PubChem CID 121303625) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxo-3-prop-2-enylheptanoic acid.
| Compound Name | (3R,4S,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxo-3-prop-2-enylheptanoic acid |
|---|---|
| PubChem CID | 121303625 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5,6,7-pentahydroxy-2-oxo-3-prop-2-enylheptanoic acid |
| SMILES | C=CC[C@](O)(C(=O)C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H16O8/c1-2-3-10(18,8(15)9(16)17)7(14)6(13)5(12)4-11/h2,5-7,11-14,18H,1,3-4H2,(H,16,17)/t5-,6-,7+,10-/m1/s1 |
| InChIKey | PTAZZEXECIYATN-QGOVLLJGSA-N |
| XLogP | -2.98 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|