C9H7BrCl2F3NO2S — CID 121303759
4-bromo-2,3-dichloro-N-[(2R)-1,1,1-trifluoropropan-2-yl]benzenesulfonamide (PubChem CID 121303759) has the molecular formula C9H7BrCl2F3NO2S and a molecular weight of 401.03 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[(2R)-1,1,1-trifluoropropan-2-yl]benzenesulfonamide.
| Compound Name | 4-bromo-2,3-dichloro-N-[(2R)-1,1,1-trifluoropropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 121303759 |
| Molecular Formula | C9H7BrCl2F3NO2S |
| Molecular Weight | 401.03 g/mol |
| Exact Mass | 398.87 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[(2R)-1,1,1-trifluoropropan-2-yl]benzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(Br)c(Cl)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C9H7BrCl2F3NO2S/c1-4(9(13,14)15)16-19(17,18)6-3-2-5(10)7(11)8(6)12/h2-4,16H,1H3/t4-/m1/s1 |
| InChIKey | GFQCKDZMVOWIOE-SCSAIBSYSA-N |
| XLogP | 3.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|