morpholin-2-ylsulfamic acid

C4H10N2O4S — CID 121304277

IUPACmorpholin-2-ylsulfamic acid
SMILESO=S(=O)(O)NC1CNCCO1
InChIInChI=1S/C4H10N2O4S/c7-11(8,9)6-4-3-5-1-2-10-4/h4-6H,1-3H2,(H,7,8,9)
InChIKeyZXRBLWKOIRWFBI-UHFFFAOYSA-N
MW182.20 g/mol
LogP-1.68
Rot. Bonds2

About morpholin-2-ylsulfamic acid

morpholin-2-ylsulfamic acid (PubChem CID 121304277) has the molecular formula C4H10N2O4S and a molecular weight of 182.20 g/mol. Its IUPAC name is morpholin-2-ylsulfamic acid.

Molecular Properties

Compound Namemorpholin-2-ylsulfamic acid
PubChem CID121304277
Molecular FormulaC4H10N2O4S
Molecular Weight182.20 g/mol
Exact Mass182.04
IUPAC Namemorpholin-2-ylsulfamic acid
SMILESO=S(=O)(O)NC1CNCCO1
InChIInChI=1S/C4H10N2O4S/c7-11(8,9)6-4-3-5-1-2-10-4/h4-6H,1-3H2,(H,7,8,9)
InChIKeyZXRBLWKOIRWFBI-UHFFFAOYSA-N
XLogP-1.68
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.20
LogP ≤ 5-1.68
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze morpholin-2-ylsulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholin-2-ylsulfamic acid?
The IUPAC name of morpholin-2-ylsulfamic acid (CID 121304277) is morpholin-2-ylsulfamic acid.
What is the SMILES notation for morpholin-2-ylsulfamic acid?
The canonical SMILES for morpholin-2-ylsulfamic acid is O=S(=O)(O)NC1CNCCO1.
What is the InChIKey of morpholin-2-ylsulfamic acid?
The InChIKey is ZXRBLWKOIRWFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O4S/c7-11(8,9)6-4-3-5-1-2-10-4/h4-6H,1-3H2,(H,7,8,9).
What are the key properties of morpholin-2-ylsulfamic acid?
morpholin-2-ylsulfamic acid has a molecular weight of 182.20 g/mol, XLogP of -1.68, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-ylsulfamic acid is sourced from PubChem (CID 121304277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).