About 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid
2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 121304289) has the molecular formula C10H12F2O3
and a molecular weight of 218.20 g/mol. Its IUPAC name is 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 121304289 |
| Molecular Formula | C10H12F2O3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCOC1(F)C=CC=C(F)C1C(=O)O |
| InChI | InChI=1S/C10H12F2O3/c1-2-6-15-10(12)5-3-4-7(11)8(10)9(13)14/h3-5,8H,2,6H2,1H3,(H,13,14) |
| InChIKey | DPSIUBPOKROXPB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid (CID 121304289) is 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid is CCCOC1(F)C=CC=C(F)C1C(=O)O.
What is the InChIKey of 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is DPSIUBPOKROXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2O3/c1-2-6-15-10(12)5-3-4-7(11)8(10)9(13)14/h3-5,8H,2,6H2,1H3,(H,13,14).
What are the key properties of 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid?
2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 218.20 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-6-propoxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 121304289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).