C28H29F3N6OS — CID 121304522
5-methyl-3-[4-[4-methyl-5-[3-[(2R,3S)-2-[4-(trifluoromethyl)phenyl]-5-azaspiro[2.4]heptan-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]phenyl]-1,2,4-oxadiazole (PubChem CID 121304522) has the molecular formula C28H29F3N6OS and a molecular weight of 554.64 g/mol. Its IUPAC name is 5-methyl-3-[4-[4-methyl-5-[3-[(2R,3S)-2-[4-(trifluoromethyl)phenyl]-5-azaspiro[2.4]heptan-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-methyl-3-[4-[4-methyl-5-[3-[(2R,3S)-2-[4-(trifluoromethyl)phenyl]-5-azaspiro[2.4]heptan-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 121304522 |
| Molecular Formula | C28H29F3N6OS |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 5-methyl-3-[4-[4-methyl-5-[3-[(2R,3S)-2-[4-(trifluoromethyl)phenyl]-5-azaspiro[2.4]heptan-5-yl]propylsulfanyl]-1,2,4-triazol-3-yl]phenyl]-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2ccc(-c3nnc(SCCCN4CC[C@]5(C[C@@H]5c5ccc(C(F)(F)F)cc5)C4)n3C)cc2)no1 |
| InChI | InChI=1S/C28H29F3N6OS/c1-18-32-24(35-38-18)20-4-6-21(7-5-20)25-33-34-26(36(25)2)39-15-3-13-37-14-12-27(17-37)16-23(27)19-8-10-22(11-9-19)28(29,30)31/h4-11,23H,3,12-17H2,1-2H3/t23-,27+/m1/s1 |
| InChIKey | CCKIRENVCMGNMA-KCWPFWIISA-N |
| XLogP | 6.22 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|