About 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane
1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane (PubChem CID 121304849) has the molecular formula C14H21BrF3N3O
and a molecular weight of 384.24 g/mol. Its IUPAC name is 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane.
Molecular Properties
| Compound Name | 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane |
| PubChem CID | 121304849 |
| Molecular Formula | C14H21BrF3N3O |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane |
| SMILES | N.NCC(Cc1ccc(Br)cc1)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H18BrF3N2O.H3N/c15-11-3-1-10(2-4-11)7-12(8-19)20-6-5-13(21,9-20)14(16,17)18;/h1-4,12,21H,5-9,19H2;1H3 |
| InChIKey | ZLFWLJNUKTVDBG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane?
The IUPAC name of 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane (CID 121304849) is 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane.
What is the SMILES notation for 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane?
The canonical SMILES for 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane is N.NCC(Cc1ccc(Br)cc1)N1CCC(O)(C(F)(F)F)C1.
What is the InChIKey of 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane?
The InChIKey is ZLFWLJNUKTVDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrF3N2O.H3N/c15-11-3-1-10(2-4-11)7-12(8-19)20-6-5-13(21,9-20)14(16,17)18;/h1-4,12,21H,5-9,19H2;1H3.
What are the key properties of 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane?
1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane has a molecular weight of 384.24 g/mol, XLogP of 2.48, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-amino-3-(4-bromophenyl)propan-2-yl]-3-(trifluoromethyl)pyrrolidin-3-ol;azane is sourced from PubChem (CID 121304849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).