About 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol
7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol (PubChem CID 121306073) has the molecular formula C8H9BrN2O
and a molecular weight of 229.08 g/mol. Its IUPAC name is 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol.
Molecular Properties
| Compound Name | 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol |
| PubChem CID | 121306073 |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol |
| SMILES | CC1(O)CN2C=CC(Br)=CC2=N1 |
| InChI | InChI=1S/C8H9BrN2O/c1-8(12)5-11-3-2-6(9)4-7(11)10-8/h2-4,12H,5H2,1H3 |
| InChIKey | WFYNAUZCTOUVOR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol?
The IUPAC name of 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol (CID 121306073) is 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol.
What is the SMILES notation for 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol?
The canonical SMILES for 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol is CC1(O)CN2C=CC(Br)=CC2=N1.
What is the InChIKey of 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol?
The InChIKey is WFYNAUZCTOUVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2O/c1-8(12)5-11-3-2-6(9)4-7(11)10-8/h2-4,12H,5H2,1H3.
What are the key properties of 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol?
7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol has a molecular weight of 229.08 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-methyl-3H-imidazo[1,2-a]pyridin-2-ol is sourced from PubChem (CID 121306073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).