C25H44N2 — CID 121306107
8-[(E,6E)-6-(azocan-2-ylidene)-2,5,5-trimethylhex-3-en-2-yl]-4,4-dimethyl-3,5,6,7-tetrahydro-2H-azocine (PubChem CID 121306107) has the molecular formula C25H44N2 and a molecular weight of 372.64 g/mol. Its IUPAC name is 8-[(E,6E)-6-(azocan-2-ylidene)-2,5,5-trimethylhex-3-en-2-yl]-4,4-dimethyl-3,5,6,7-tetrahydro-2H-azocine.
| Compound Name | 8-[(E,6E)-6-(azocan-2-ylidene)-2,5,5-trimethylhex-3-en-2-yl]-4,4-dimethyl-3,5,6,7-tetrahydro-2H-azocine |
|---|---|
| PubChem CID | 121306107 |
| Molecular Formula | C25H44N2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.35 |
| IUPAC Name | 8-[(E,6E)-6-(azocan-2-ylidene)-2,5,5-trimethylhex-3-en-2-yl]-4,4-dimethyl-3,5,6,7-tetrahydro-2H-azocine |
| SMILES | CC(C)(/C=C/C(C)(C)/C1=N/CCC(C)(C)CCC1)/C=C1\CCCCCCN1 |
| InChI | InChI=1S/C25H44N2/c1-23(2)14-11-13-22(27-19-17-23)25(5,6)16-15-24(3,4)20-21-12-9-7-8-10-18-26-21/h15-16,20,26H,7-14,17-19H2,1-6H3/b16-15+,21-20+,27-22+ |
| InChIKey | QIZNXRZJDWZJBU-VTZMQDKDSA-N |
| XLogP | 7.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|