C27H28N2O3 — CID 121306127
2-[2-(N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-5-methoxy-2-methylanilino)prop-2-enyl]isoindole-1,3-dione (PubChem CID 121306127) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[2-(N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-5-methoxy-2-methylanilino)prop-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-5-methoxy-2-methylanilino)prop-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 121306127 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[2-(N-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]-5-methoxy-2-methylanilino)prop-2-enyl]isoindole-1,3-dione |
| SMILES | C=C/C(=C\C=C/C)CN(C(=C)CN1C(=O)c2ccccc2C1=O)c1cc(OC)ccc1C |
| InChI | InChI=1S/C27H28N2O3/c1-6-8-11-21(7-2)18-28(25-16-22(32-5)15-14-19(25)3)20(4)17-29-26(30)23-12-9-10-13-24(23)27(29)31/h6-16H,2,4,17-18H2,1,3,5H3/b8-6-,21-11+ |
| InChIKey | FOYSITRRZRZNFQ-DDXVOHCGSA-N |
| XLogP | 5.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|