C23H34N6O2 — CID 121306632
9-[(E)-1-aminopent-2-en-2-yl]-1-(1-propanoylpiperidin-4-yl)-3,4,5,6,9,10-hexahydropyrimido[5,4-c][1,5]naphthyridin-2-one (PubChem CID 121306632) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 9-[(E)-1-aminopent-2-en-2-yl]-1-(1-propanoylpiperidin-4-yl)-3,4,5,6,9,10-hexahydropyrimido[5,4-c][1,5]naphthyridin-2-one.
| Compound Name | 9-[(E)-1-aminopent-2-en-2-yl]-1-(1-propanoylpiperidin-4-yl)-3,4,5,6,9,10-hexahydropyrimido[5,4-c][1,5]naphthyridin-2-one |
|---|---|
| PubChem CID | 121306632 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 9-[(E)-1-aminopent-2-en-2-yl]-1-(1-propanoylpiperidin-4-yl)-3,4,5,6,9,10-hexahydropyrimido[5,4-c][1,5]naphthyridin-2-one |
| SMILES | CC/C=C(\CN)C1C=CC2=C(N1)C1=C(CNC(=O)N1C1CCN(C(=O)CC)CC1)CN2 |
| InChI | InChI=1S/C23H34N6O2/c1-3-5-15(12-24)18-6-7-19-21(27-18)22-16(13-25-19)14-26-23(31)29(22)17-8-10-28(11-9-17)20(30)4-2/h5-7,17-18,25,27H,3-4,8-14,24H2,1-2H3,(H,26,31)/b15-5+ |
| InChIKey | MBWGHTBBTKUYCP-PJQLUOCWSA-N |
| XLogP | 1.30 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|