C12H20FN — CID 121306892
4-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]-1-methylpiperidine (PubChem CID 121306892) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is 4-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]-1-methylpiperidine.
| Compound Name | 4-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 121306892 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 4-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]-1-methylpiperidine |
| SMILES | C/C(F)=C\C=C(/C)C1CCN(C)CC1 |
| InChI | InChI=1S/C12H20FN/c1-10(4-5-11(2)13)12-6-8-14(3)9-7-12/h4-5,12H,6-9H2,1-3H3/b10-4+,11-5+ |
| InChIKey | KQTKBFRSEZTGFH-ZVSIBQGLSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|