About (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine
(4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine (PubChem CID 121307032) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine.
Molecular Properties
| Compound Name | (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine |
| PubChem CID | 121307032 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine |
| SMILES | [H]/N=C/CC(=C)[C@H](C)C/C=C\C=C |
| InChI | InChI=1S/C11H17N/c1-4-5-6-7-10(2)11(3)8-9-12/h4-6,9-10,12H,1,3,7-8H2,2H3/b6-5-,12-9+/t10-/m1/s1 |
| InChIKey | DMKCITVJLBASFY-YSTARBRHSA-N |
| XLogP | 3.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine?
The IUPAC name of (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine (CID 121307032) is (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine.
What is the SMILES notation for (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine?
The canonical SMILES for (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine is [H]/N=C/CC(=C)[C@H](C)C/C=C\C=C.
What is the InChIKey of (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine?
The InChIKey is DMKCITVJLBASFY-YSTARBRHSA-N. The full InChI is InChI=1S/C11H17N/c1-4-5-6-7-10(2)11(3)8-9-12/h4-6,9-10,12H,1,3,7-8H2,2H3/b6-5-,12-9+/t10-/m1/s1.
What are the key properties of (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine?
(4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine has a molecular weight of 163.26 g/mol, XLogP of 3.35, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6Z)-4-methyl-3-methylidenenona-6,8-dien-1-imine is sourced from PubChem (CID 121307032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).