C36H54N2 — CID 121307525
(9aR)-3-[(4bS)-9-cyclohex-2-en-1-yl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazol-3-yl]-9-cyclohex-2-en-1-yl-1,2,3,4,4a,4b,7,8,8a,9a-decahydrocarbazole (PubChem CID 121307525) has the molecular formula C36H54N2 and a molecular weight of 514.84 g/mol. Its IUPAC name is (9aR)-3-[(4bS)-9-cyclohex-2-en-1-yl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazol-3-yl]-9-cyclohex-2-en-1-yl-1,2,3,4,4a,4b,7,8,8a,9a-decahydrocarbazole.
| Compound Name | (9aR)-3-[(4bS)-9-cyclohex-2-en-1-yl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazol-3-yl]-9-cyclohex-2-en-1-yl-1,2,3,4,4a,4b,7,8,8a,9a-decahydrocarbazole |
|---|---|
| PubChem CID | 121307525 |
| Molecular Formula | C36H54N2 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.43 |
| IUPAC Name | (9aR)-3-[(4bS)-9-cyclohex-2-en-1-yl-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrocarbazol-3-yl]-9-cyclohex-2-en-1-yl-1,2,3,4,4a,4b,7,8,8a,9a-decahydrocarbazole |
| SMILES | C1=CC(N2C3CCC(C4CC[C@@H]5C(C4)C4C=CCCC4N5C4C=CCCC4)CC3[C@@H]3CCCCC32)CCC1 |
| InChI | InChI=1S/C36H54N2/c1-3-11-27(12-4-1)37-33-17-9-7-15-29(33)31-23-25(19-21-35(31)37)26-20-22-36-32(24-26)30-16-8-10-18-34(30)38(36)28-13-5-2-6-14-28/h3,5,7,11,13,15,25-36H,1-2,4,6,8-10,12,14,16-24H2/t25?,26?,27?,28?,29?,30-,31?,32?,33?,34?,35+,36?/m0/s1 |
| InChIKey | DAORAQMIGMMDRT-PFGONNEDSA-N |
| XLogP | 8.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|