C25H26N2O6 — CID 121307592
ethyl 3-[2,4,6-trioxo-5-(3-oxobutyl)-1,3-diphenyl-1,3-diazinan-5-yl]propanoate (PubChem CID 121307592) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is ethyl 3-[2,4,6-trioxo-5-(3-oxobutyl)-1,3-diphenyl-1,3-diazinan-5-yl]propanoate.
| Compound Name | ethyl 3-[2,4,6-trioxo-5-(3-oxobutyl)-1,3-diphenyl-1,3-diazinan-5-yl]propanoate |
|---|---|
| PubChem CID | 121307592 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | ethyl 3-[2,4,6-trioxo-5-(3-oxobutyl)-1,3-diphenyl-1,3-diazinan-5-yl]propanoate |
| SMILES | CCOC(=O)CCC1(CCC(C)=O)C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H26N2O6/c1-3-33-21(29)15-17-25(16-14-18(2)28)22(30)26(19-10-6-4-7-11-19)24(32)27(23(25)31)20-12-8-5-9-13-20/h4-13H,3,14-17H2,1-2H3 |
| InChIKey | HHAPUAHMIZQKPV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|