C28H32N2O7 — CID 121307903
ethyl 3-[5,5-dibenzyl-3-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanoate (PubChem CID 121307903) has the molecular formula C28H32N2O7 and a molecular weight of 508.57 g/mol. Its IUPAC name is ethyl 3-[5,5-dibenzyl-3-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanoate.
| Compound Name | ethyl 3-[5,5-dibenzyl-3-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanoate |
|---|---|
| PubChem CID | 121307903 |
| Molecular Formula | C28H32N2O7 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | ethyl 3-[5,5-dibenzyl-3-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1C(=O)N(CCC(=O)OCC)C(=O)C(Cc2ccccc2)(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H32N2O7/c1-3-36-23(31)15-17-29-25(33)28(19-21-11-7-5-8-12-21,20-22-13-9-6-10-14-22)26(34)30(27(29)35)18-16-24(32)37-4-2/h5-14H,3-4,15-20H2,1-2H3 |
| InChIKey | HUWDUTGJAREUJE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|