C23H23Cl2F6N3O4S — CID 121307922
4-N-cyclobutyl-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-N-(2-hydroxy-2-methylpropyl)-4-N-methyl-1,3-thiazole-2,4-dicarboxamide (PubChem CID 121307922) has the molecular formula C23H23Cl2F6N3O4S and a molecular weight of 622.42 g/mol. Its IUPAC name is 4-N-cyclobutyl-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-N-(2-hydroxy-2-methylpropyl)-4-N-methyl-1,3-thiazole-2,4-dicarboxamide.
| Compound Name | 4-N-cyclobutyl-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-N-(2-hydroxy-2-methylpropyl)-4-N-methyl-1,3-thiazole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 121307922 |
| Molecular Formula | C23H23Cl2F6N3O4S |
| Molecular Weight | 622.42 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | 4-N-cyclobutyl-5-[2,3-dichloro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-N-(2-hydroxy-2-methylpropyl)-4-N-methyl-1,3-thiazole-2,4-dicarboxamide |
| SMILES | CN(C(=O)c1nc(C(=O)NCC(C)(C)O)sc1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)c(Cl)c1Cl)C1CCC1 |
| InChI | InChI=1S/C23H23Cl2F6N3O4S/c1-20(2,37)9-32-17(35)18-33-15(19(36)34(3)10-5-4-6-10)16(39-18)11-7-8-12(14(25)13(11)24)21(38,22(26,27)28)23(29,30)31/h7-8,10,37-38H,4-6,9H2,1-3H3,(H,32,35) |
| InChIKey | OAGAIQVHCFYVBR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |