C26H28N2O7 — CID 121307925
ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-yl]propanoate (PubChem CID 121307925) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-yl]propanoate.
| Compound Name | ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-yl]propanoate |
|---|---|
| PubChem CID | 121307925 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-yl]propanoate |
| SMILES | CCOC(=O)CCC1(CCC(=O)OCC)C(=O)N(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H28N2O7/c1-3-34-21(29)15-17-26(18-16-22(30)35-4-2)23(31)27(19-11-7-5-8-12-19)25(33)28(24(26)32)20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3 |
| InChIKey | JUXUFUSHKDEMAC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|