C20H24N2O7 — CID 121307935
ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]propanoate (PubChem CID 121307935) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]propanoate.
| Compound Name | ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]propanoate |
|---|---|
| PubChem CID | 121307935 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]propanoate |
| SMILES | CCOC(=O)CCC1(CCC(=O)OCC)C(=O)NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H24N2O7/c1-3-28-15(23)10-12-20(13-11-16(24)29-4-2)17(25)21-19(27)22(18(20)26)14-8-6-5-7-9-14/h5-9H,3-4,10-13H2,1-2H3,(H,21,25,27) |
| InChIKey | DKEYGYNWTXJWGR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|