About 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide
2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide (PubChem CID 121308341) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 121308341 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1sc(C#N)nc1C(=O)N(C)C |
| InChI | InChI=1S/C8H9N3OS/c1-5-7(8(12)11(2)3)10-6(4-9)13-5/h1-3H3 |
| InChIKey | YSIPVZFAXNCXFW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide (CID 121308341) is 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide is Cc1sc(C#N)nc1C(=O)N(C)C.
What is the InChIKey of 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide?
The InChIKey is YSIPVZFAXNCXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-5-7(8(12)11(2)3)10-6(4-9)13-5/h1-3H3.
What are the key properties of 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide?
2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide has a molecular weight of 195.25 g/mol, XLogP of 1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N,N,5-trimethyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 121308341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).