C26H26N4O6 — CID 121308880
1-[4-methyl-5-(2,4,6-trioxo-3-phenyl-1,3-diazinan-1-yl)pentyl]-3-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 121308880) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is 1-[4-methyl-5-(2,4,6-trioxo-3-phenyl-1,3-diazinan-1-yl)pentyl]-3-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[4-methyl-5-(2,4,6-trioxo-3-phenyl-1,3-diazinan-1-yl)pentyl]-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 121308880 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 1-[4-methyl-5-(2,4,6-trioxo-3-phenyl-1,3-diazinan-1-yl)pentyl]-3-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(CCCN1C(=O)CC(=O)N(c2ccccc2)C1=O)CN1C(=O)CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H26N4O6/c1-18(17-28-22(32)16-24(34)30(26(28)36)20-12-6-3-7-13-20)9-8-14-27-21(31)15-23(33)29(25(27)35)19-10-4-2-5-11-19/h2-7,10-13,18H,8-9,14-17H2,1H3 |
| InChIKey | TXWGSBWXLWPENP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 115.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|