C50H58O2S2 — CID 121309416
2,12-bis(3,7-dimethyloctyl)-7,17-bis(5-methylthiophen-2-yl)pentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene-6,16-dione (PubChem CID 121309416) has the molecular formula C50H58O2S2 and a molecular weight of 755.15 g/mol. Its IUPAC name is 2,12-bis(3,7-dimethyloctyl)-7,17-bis(5-methylthiophen-2-yl)pentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene-6,16-dione.
| Compound Name | 2,12-bis(3,7-dimethyloctyl)-7,17-bis(5-methylthiophen-2-yl)pentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene-6,16-dione |
|---|---|
| PubChem CID | 121309416 |
| Molecular Formula | C50H58O2S2 |
| Molecular Weight | 755.15 g/mol |
| Exact Mass | 754.39 |
| IUPAC Name | 2,12-bis(3,7-dimethyloctyl)-7,17-bis(5-methylthiophen-2-yl)pentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene-6,16-dione |
| SMILES | Cc1ccc(-c2cc3cc4c(CCC(C)CCCC(C)C)c5cc6c(=O)c(-c7ccc(C)s7)cc6cc5c(CCC(C)CCCC(C)C)c4cc3c2=O)s1 |
| InChI | InChI=1S/C50H58O2S2/c1-29(2)11-9-13-31(5)15-19-37-41-23-35-25-45(47-21-17-33(7)53-47)50(52)40(35)28-44(41)38(20-16-32(6)14-10-12-30(3)4)42-24-36-26-46(48-22-18-34(8)54-48)49(51)39(36)27-43(37)42/h17-18,21-32H,9-16,19-20H2,1-8H3 |
| InChIKey | GUPVWJYGQUGDQE-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.15 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|