About methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate
methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate (PubChem CID 121309984) has the molecular formula C12H25O3PS
and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate |
| PubChem CID | 121309984 |
| Molecular Formula | C12H25O3PS |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate |
| SMILES | COC(=O)C(C)(C)C(C)P(=S)(OC)C(C)(C)C |
| InChI | InChI=1S/C12H25O3PS/c1-9(12(5,6)10(13)14-7)16(17,15-8)11(2,3)4/h9H,1-8H3 |
| InChIKey | QJKMJBXRLNRKTM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate?
The IUPAC name of methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate (CID 121309984) is methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate.
What is the SMILES notation for methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate?
The canonical SMILES for methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate is COC(=O)C(C)(C)C(C)P(=S)(OC)C(C)(C)C.
What is the InChIKey of methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate?
The InChIKey is QJKMJBXRLNRKTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25O3PS/c1-9(12(5,6)10(13)14-7)16(17,15-8)11(2,3)4/h9H,1-8H3.
What are the key properties of methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate?
methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate has a molecular weight of 280.37 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[tert-butyl(methoxy)phosphinothioyl]-2,2-dimethylbutanoate is sourced from PubChem (CID 121309984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).