About 2,3-di(hexanoyloxy)propyl hexanoate
2,3-di(hexanoyloxy)propyl hexanoate (PubChem CID 12131) has the molecular formula C21H38O6
and a molecular weight of 386.53 g/mol. Its IUPAC name is 2,3-di(hexanoyloxy)propyl hexanoate.
Molecular Properties
| Compound Name | 2,3-di(hexanoyloxy)propyl hexanoate |
| PubChem CID | 12131 |
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 2,3-di(hexanoyloxy)propyl hexanoate |
| SMILES | CCCCCC(=O)OCC(COC(=O)CCCCC)OC(=O)CCCCC |
| InChI | InChI=1S/C21H38O6/c1-4-7-10-13-19(22)25-16-18(27-21(24)15-12-9-6-3)17-26-20(23)14-11-8-5-2/h18H,4-17H2,1-3H3 |
| InChIKey | MAYCICSNZYXLHB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-di(hexanoyloxy)propyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(hexanoyloxy)propyl hexanoate?
The IUPAC name of 2,3-di(hexanoyloxy)propyl hexanoate (CID 12131) is 2,3-di(hexanoyloxy)propyl hexanoate.
What is the SMILES notation for 2,3-di(hexanoyloxy)propyl hexanoate?
The canonical SMILES for 2,3-di(hexanoyloxy)propyl hexanoate is CCCCCC(=O)OCC(COC(=O)CCCCC)OC(=O)CCCCC.
What is the InChIKey of 2,3-di(hexanoyloxy)propyl hexanoate?
The InChIKey is MAYCICSNZYXLHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O6/c1-4-7-10-13-19(22)25-16-18(27-21(24)15-12-9-6-3)17-26-20(23)14-11-8-5-2/h18H,4-17H2,1-3H3.
What are the key properties of 2,3-di(hexanoyloxy)propyl hexanoate?
2,3-di(hexanoyloxy)propyl hexanoate has a molecular weight of 386.53 g/mol, XLogP of 4.73, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(hexanoyloxy)propyl hexanoate is sourced from PubChem (CID 12131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).