C55H37N3 — CID 121311645
2-[3-[3-(4-naphthalen-1-ylphenyl)-5-(3-phenylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 121311645) has the molecular formula C55H37N3 and a molecular weight of 739.92 g/mol. Its IUPAC name is 2-[3-[3-(4-naphthalen-1-ylphenyl)-5-(3-phenylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-(4-naphthalen-1-ylphenyl)-5-(3-phenylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 121311645 |
| Molecular Formula | C55H37N3 |
| Molecular Weight | 739.92 g/mol |
| Exact Mass | 739.30 |
| IUPAC Name | 2-[3-[3-(4-naphthalen-1-ylphenyl)-5-(3-phenylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccc(-c5cccc6ccccc56)cc4)cc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C55H37N3/c1-4-15-38(16-5-1)44-23-12-24-45(33-44)49-35-48(39-29-31-41(32-30-39)52-28-14-22-40-17-10-11-27-51(40)52)36-50(37-49)46-25-13-26-47(34-46)55-57-53(42-18-6-2-7-19-42)56-54(58-55)43-20-8-3-9-21-43/h1-37H |
| InChIKey | FNXVSBQQJJGOIS-UHFFFAOYSA-N |
| XLogP | 14.36 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.92 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |