C69H43N7 — CID 121311657
5-[4-[3-[3-[4-[3-[3-[4-(1,10-phenanthrolin-5-yl)phenyl]phenyl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]-1,10-phenanthroline (PubChem CID 121311657) has the molecular formula C69H43N7 and a molecular weight of 970.15 g/mol. Its IUPAC name is 5-[4-[3-[3-[4-[3-[3-[4-(1,10-phenanthrolin-5-yl)phenyl]phenyl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]-1,10-phenanthroline.
| Compound Name | 5-[4-[3-[3-[4-[3-[3-[4-(1,10-phenanthrolin-5-yl)phenyl]phenyl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 121311657 |
| Molecular Formula | C69H43N7 |
| Molecular Weight | 970.15 g/mol |
| Exact Mass | 969.36 |
| IUPAC Name | 5-[4-[3-[3-[4-[3-[3-[4-(1,10-phenanthrolin-5-yl)phenyl]phenyl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2nc(-c3cccc(-c4cccc(-c5ccc(-c6cc7cccnc7c7ncccc67)cc5)c4)c3)nc(-c3cccc(-c4cccc(-c5ccc(-c6cc7cccnc7c7ncccc67)cc5)c4)c3)n2)cc1 |
| InChI | InChI=1S/C69H43N7/c1-2-12-48(13-3-1)67-74-68(57-20-6-18-53(40-57)51-16-4-14-49(38-51)44-26-30-46(31-27-44)61-42-55-22-8-34-70-63(55)65-59(61)24-10-36-72-65)76-69(75-67)58-21-7-19-54(41-58)52-17-5-15-50(39-52)45-28-32-47(33-29-45)62-43-56-23-9-35-71-64(56)66-60(62)25-11-37-73-66/h1-43H |
| InChIKey | CGIPGGRXGSGXMZ-UHFFFAOYSA-N |
| XLogP | 17.07 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.15 |
| LogP ≤ 5 | 17.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|