C10H13ClN2O — CID 121311880
4-(6-chloropyrimidin-4-yl)-3,3-dimethylbutan-2-one (PubChem CID 121311880) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 4-(6-chloropyrimidin-4-yl)-3,3-dimethylbutan-2-one.
| Compound Name | 4-(6-chloropyrimidin-4-yl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 121311880 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 4-(6-chloropyrimidin-4-yl)-3,3-dimethylbutan-2-one |
| SMILES | CC(=O)C(C)(C)Cc1cc(Cl)ncn1 |
| InChI | InChI=1S/C10H13ClN2O/c1-7(14)10(2,3)5-8-4-9(11)13-6-12-8/h4,6H,5H2,1-3H3 |
| InChIKey | XDERUNLOBXJQJI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |