C18H19Cl6N5 — CID 121312122
N-[(1-aminocyclohexyl)methyl]-4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 121312122) has the molecular formula C18H19Cl6N5 and a molecular weight of 518.10 g/mol. Its IUPAC name is N-[(1-aminocyclohexyl)methyl]-4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | N-[(1-aminocyclohexyl)methyl]-4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 121312122 |
| Molecular Formula | C18H19Cl6N5 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 514.98 |
| IUPAC Name | N-[(1-aminocyclohexyl)methyl]-4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | NC1(CNc2nc(-c3ccc(C(Cl)(Cl)Cl)cc3)nc(C(Cl)(Cl)Cl)n2)CCCCC1 |
| InChI | InChI=1S/C18H19Cl6N5/c19-17(20,21)12-6-4-11(5-7-12)13-27-14(18(22,23)24)29-15(28-13)26-10-16(25)8-2-1-3-9-16/h4-7H,1-3,8-10,25H2,(H,26,27,28,29) |
| InChIKey | QRTDSRFJAYHXOR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|