C18H19Cl6N5O — CID 121312138
2-[4-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanol (PubChem CID 121312138) has the molecular formula C18H19Cl6N5O and a molecular weight of 534.10 g/mol. Its IUPAC name is 2-[4-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 121312138 |
| Molecular Formula | C18H19Cl6N5O |
| Molecular Weight | 534.10 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | 2-[4-[4-(trichloromethyl)-6-[4-(trichloromethyl)phenyl]-1,3,5-triazin-2-yl]-1,4-diazepan-1-yl]ethanol |
| SMILES | OCCN1CCCN(c2nc(-c3ccc(C(Cl)(Cl)Cl)cc3)nc(C(Cl)(Cl)Cl)n2)CC1 |
| InChI | InChI=1S/C18H19Cl6N5O/c19-17(20,21)13-4-2-12(3-5-13)14-25-15(18(22,23)24)27-16(26-14)29-7-1-6-28(8-9-29)10-11-30/h2-5,30H,1,6-11H2 |
| InChIKey | PCMPMTCYYFYOTH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.10 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|